776277-76-0 Usage
General Description
FMOC-HOMOARG-OH, also known as N-α-9-fluorenylmethyloxycarbonyl-N^ω-(2,2,5,7,8-pentamethylchromane-6-sulfonyl)-L-homoarginine, is a chemical compound commonly used in the field of peptide chemistry. It is a derivative of the amino acid homoarginine and is often employed as a protecting group in the synthesis of peptide chains. The FMOC group serves to temporarily block the reactive sites on the homoarginine molecule, allowing for controlled and selective reactions during the peptide synthesis process. Additionally, the chromane-6-sulfonyl group also plays a role in protecting the amino acid, and can be easily removed under mild conditions when required. Overall, FMOC-HOMOARG-OH is a valuable tool for the construction of complex peptide structures in biological and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 776277-76-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,6,2,7 and 7 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 776277-76:
(8*7)+(7*7)+(6*6)+(5*2)+(4*7)+(3*7)+(2*7)+(1*6)=220
220 % 10 = 0
So 776277-76-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N4O4/c23-21(24)25-12-6-5-11-19(20(27)28)26-22(29)30-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18-19H,5-6,11-13H2,(H,26,29)(H,27,28)(H4,23,24,25)/t19-/m0/s1