77633-05-7 Usage
Uses
Used in Organic Synthesis:
2,4,6-Cycloheptatrien-1-one, 3-[3-(1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-2-hydroxyis used as a reactive intermediate in organic synthesis for the formation of various complex organic molecules. Its unique structure allows for multiple points of reactivity, making it a promising candidate for the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2,4,6-Cycloheptatrien-1-one, 3-[3-(1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-2-hydroxyis utilized as a building block for the development of novel therapeutic agents. Its structural features may contribute to the design of new drugs with improved pharmacological properties, such as enhanced potency, selectivity, and reduced side effects.
Used in Pharmaceutical Industry:
2,4,6-Cycloheptatrien-1-one, 3-[3-(1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-2-hydroxyis employed as a key component in the synthesis of pharmaceutical compounds. Its unique structural elements can be leveraged to create innovative drug candidates with potential applications in various therapeutic areas, such as oncology, neurology, and cardiovascular diseases.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4,6-Cycloheptatrien-1-one, 3-[3-(1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-2-hydroxyis utilized as a precursor for the development of new pesticides and herbicides. Its reactivity and structural features can be harnessed to create more effective and environmentally friendly agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 77633-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,6,3 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 77633-05:
(7*7)+(6*7)+(5*6)+(4*3)+(3*3)+(2*0)+(1*5)=147
147 % 10 = 7
So 77633-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H12O5/c18-13(12-3-1-2-4-14(19)17(12)20)7-5-11-6-8-15-16(9-11)22-10-21-15/h1-9H,10H2,(H,19,20)/b7-5+
