77636-92-1 Usage
Chemical class
Imidazole derivatives
Molecular weight
243.66 g/mol
Physical form
Bright orange solid
Uses
Organic chemistry and pharmaceutical research, dye and pigment in various industries
Potential applications
Medicinal chemistry and drug development
Additional information
Unique chemical structure and properties, further research needed to understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 77636-92-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,6,3 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 77636-92:
(7*7)+(6*7)+(5*6)+(4*3)+(3*6)+(2*9)+(1*2)=171
171 % 10 = 1
So 77636-92-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN4O.ClH/c1-16-9-3-2-7(11)6-8(9)14-15-10-12-4-5-13-10;/h2-6,14H,1H3;1H
