778-56-3 Usage
Uses
Used in Pharmaceutical Synthesis:
1-(4-Fluoro-2-nitrophenyl)pyrrolidine is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with specific therapeutic properties. The presence of the fluorine and nitro groups can influence the pharmacokinetics and pharmacodynamics of the resulting compounds, potentially enhancing their efficacy and safety.
Used in Agrochemical Production:
In the agrochemical industry, 1-(4-Fluoro-2-nitrophenyl)pyrrolidine serves as an intermediate in the synthesis of various agrochemicals, including pesticides and herbicides. Its unique chemical structure can be leveraged to create compounds with improved performance and selectivity in agricultural applications.
Used in Organic Electronics:
1-(4-Fluoro-2-nitrophenyl)pyrrolidine may have potential applications in the field of organic electronics due to its electronic properties conferred by the fluorine and nitro groups. It could be utilized in the development of organic semiconductors, sensors, or other electronic devices that require specific electronic characteristics.
Used in Materials Science:
The unique reactivity and properties of 1-(4-Fluoro-2-nitrophenyl)pyrrolidine also make it a candidate for use in materials science. It could be employed in the synthesis of new materials with tailored properties for applications in various industries, such as coatings, adhesives, or composites.
Check Digit Verification of cas no
The CAS Registry Mumber 778-56-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,7 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 778-56:
(5*7)+(4*7)+(3*8)+(2*5)+(1*6)=103
103 % 10 = 3
So 778-56-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H11FN2O2/c11-8-3-4-9(10(7-8)13(14)15)12-5-1-2-6-12/h3-4,7H,1-2,5-6H2