77825-98-0 Usage
General Description
1,2,3-Benzoxadithiole 2-oxide is a chemical compound with the molecular formula C7H4O2S2. It is a heterocyclic compound containing both oxygen and sulfur atoms in its ring structure. 1,2,3-Benzoxadithiole 2-oxide has potential applications in various fields, including organic synthesis and material science. It is used as a building block in the synthesis of various organic compounds and has been studied for its potential as an antioxidant and anti-inflammatory agent. Additionally, 1,2,3-Benzoxadithiole 2-oxide has been investigated for its potential use as a corrosion inhibitor and in the synthesis of polymers and other materials. Overall, this compound has diverse potential applications due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 77825-98-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,8,2 and 5 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 77825-98:
(7*7)+(6*7)+(5*8)+(4*2)+(3*5)+(2*9)+(1*8)=180
180 % 10 = 0
So 77825-98-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H4O2S2/c7-10-8-5-3-1-2-4-6(5)9-10/h1-4H
