77832-81-6 Usage
Description
(3-Bromo-4-hydroxyphenyl)(1-bromo-2-phenyl-3-indolizinyl)methanone is a complex organic compound characterized by the presence of a bromine atom, a hydroxyphenyl group, a phenyl group, and an indolizinyl group in its molecular structure. This unique arrangement of functional groups endows the compound with distinctive properties, making it a valuable subject of study in the realm of organic chemistry.
Uses
Used in Organic Chemistry Research:
(3-Bromo-4-hydroxyphenyl)(1-bromo-2-phenyl-3-indolizinyl)methanone serves as a key compound in organic chemistry research, where it is utilized for exploring novel synthetic pathways and understanding the reactivity and behavior of complex organic molecules.
Used in Pharmaceutical Development:
In the pharmaceutical industry, (3-Bromo-4-hydroxyphenyl)(1-bromo-2-phenyl-3-indolizinyl)methanone may be employed as a starting material or intermediate in the synthesis of new drug candidates. Its unique structure could potentially lead to the development of innovative therapeutic agents with specific pharmacological properties.
Used in Agrochemical Formulation:
(3-Bromo-4-hydroxyphenyl)(1-bromo-2-phenyl-3-indolizinyl)methanone could also find applications in the agrochemical sector, where it might be used as a component in the formulation of new pesticides or herbicides. Its chemical properties could contribute to the effectiveness of these products in managing agricultural pests and weeds.
Used in Materials Science:
In the field of materials science, (3-Bromo-4-hydroxyphenyl)(1-bromo-2-phenyl-3-indolizinyl)methanone may be investigated for its potential to contribute to the development of advanced materials with specific characteristics, such as improved stability, reactivity, or selectivity in various chemical processes.
Further research and investigation are necessary to fully explore and understand the potential uses and applications of (3-Bromo-4-hydroxyphenyl)(1-bromo-2-phenyl-3-indolizinyl)methanone across different industries. Its unique molecular structure and properties hold promise for future advancements in organic chemistry, pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 77832-81-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,8,3 and 2 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 77832-81:
(7*7)+(6*7)+(5*8)+(4*3)+(3*2)+(2*8)+(1*1)=166
166 % 10 = 6
So 77832-81-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H13Br2NO2/c22-15-12-14(9-10-17(15)25)21(26)20-18(13-6-2-1-3-7-13)19(23)16-8-4-5-11-24(16)20/h1-12,25H
77832-81-6Relevant articles and documents
Research in indolizines series: Effect of indolizine substitution in position 1 in butoprozine series
Rosseels,Peiren,Cornil,et al.
, p. 339 - 346 (2007/10/02)
The authors synthesized 2-alky and 2-aryl-3(4-dialkylaminopropoxy - substituted or unsubstituted benzoyl)-indolizines bearing in the 1-position a halogen atom or a methyl or methoxy group. They obtained useful molecules which, in addition to the usual pro