77916-94-0 Usage
Uses
Used in Pharmaceutical Research:
1-(2-Aminoethyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedione is used as a building block for the synthesis of compounds with biological activity. Its unique structure allows for the creation of new molecules that can potentially target specific biological pathways or receptors, leading to the development of innovative pharmaceutical agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(2-Aminoethyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedione serves as a valuable compound for designing and optimizing drug candidates. Its structural features can be manipulated to enhance the compound's interaction with biological targets, potentially improving the efficacy and selectivity of resulting pharmaceuticals.
Used in Drug Development:
1-(2-Aminoethyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedione is utilized in the development of new pharmaceutical agents. Its heterocyclic nature and functional groups make it a promising candidate for further modification and optimization to create drugs with improved pharmacokinetic and pharmacodynamic properties.
Used in Chemical Synthesis:
1-(2-Aminoethyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedion e is also used in chemical synthesis as an intermediate or reactant for creating a variety of complex molecules. Its reactivity and structural features can be exploited to synthesize novel compounds with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in the Chemical Industry:
In the chemical industry, 1-(2-Aminoethyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedione may be employed as a starting material or intermediate in the production of specialty chemicals, dyes, or other industrial products that require its specific structural elements.
Check Digit Verification of cas no
The CAS Registry Mumber 77916-94-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,9,1 and 6 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 77916-94:
(7*7)+(6*7)+(5*9)+(4*1)+(3*6)+(2*9)+(1*4)=180
180 % 10 = 0
So 77916-94-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H26N4O2/c1-3-19(4-2)15-7-5-14(6-8-15)13-21-12-11-20(10-9-18)16(22)17(21)23/h5-8H,3-4,9-13,18H2,1-2H3
