779353-64-9 Usage
Uses
Used in Pharmaceutical Industry:
Pyrazolo[1,5-a]pyrimidine, 5,7-dichloro-3-ethyl(9CI) is used as a potential drug candidate for its potential antiviral, antibacterial, and antitumor properties. Its unique structure and pharmacological activities make it a valuable compound for the development of new therapeutic agents to combat various diseases and conditions.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, Pyrazolo[1,5-a]pyrimidine, 5,7-dichloro-3-ethyl(9CI) serves as a promising target for further research and development. Its potential biological activities and unique structural features provide a foundation for exploring new drug discovery avenues and optimizing its therapeutic potential.
Used in Drug Design and Optimization:
Pyrazolo[1,5-a]pyrimidine, 5,7-dichloro-3-ethyl(9CI) is utilized in drug design and optimization processes to create novel compounds with improved pharmacological properties. By understanding its structure-activity relationships, researchers can modify its chemical structure to enhance its efficacy, selectivity, and safety profile, ultimately leading to the development of more effective drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 779353-64-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,9,3,5 and 3 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 779353-64:
(8*7)+(7*7)+(6*9)+(5*3)+(4*5)+(3*3)+(2*6)+(1*4)=219
219 % 10 = 9
So 779353-64-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7Cl2N3/c1-2-5-4-11-13-7(10)3-6(9)12-8(5)13/h3-4H,2H2,1H3
