78134-03-9 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Piperazinedithione,1,4-dimethyl-(9CI) is used as a pharmaceutical intermediate for the synthesis of various drugs and compounds. Its unique chemical structure allows it to be a key component in the development of new medications, contributing to advancements in healthcare and pharmaceuticals.
Used in Organic Chemistry Research:
In the field of organic chemistry, 2,3-Piperazinedithione,1,4-dimethyl-(9CI) is utilized for research purposes. Its properties and reactivity are studied to gain insights into chemical reactions and mechanisms, furthering the understanding of organic chemistry and potentially leading to the discovery of new compounds and reactions.
Used in Material Sciences:
2,3-Piperazinedithione,1,4-dimethyl-(9CI) also has potential applications in material sciences. Its unique properties may contribute to the development of new materials with specific characteristics, such as improved stability, reactivity, or other desirable traits. This can lead to innovations in various industries, including electronics, textiles, and more.
Check Digit Verification of cas no
The CAS Registry Mumber 78134-03-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,1,3 and 4 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 78134-03:
(7*7)+(6*8)+(5*1)+(4*3)+(3*4)+(2*0)+(1*3)=129
129 % 10 = 9
So 78134-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2S2/c1-7-3-4-8(2)6(10)5(7)9/h3-4H2,1-2H3
