78197-84-9 Usage
Uses
Used in Pharmaceutical Applications:
3-Hydroxyguanfacine is used as a metabolite in the pharmaceutical industry for its potential therapeutic effects. As the main metabolite of Guanfacine, it plays a crucial role in the drug's metabolism, distribution, and elimination in the body. Its presence in human plasma and urine suggests that it may contribute to the overall pharmacological action of Guanfacine, potentially enhancing its efficacy and safety profile.
Used in Research and Development:
3-Hydroxyguanfacine is used as a subject of study in the field of drug metabolism and pharmacokinetics. Understanding the properties, interactions, and effects of this metabolite can provide valuable insights into the behavior of Guanfacine and other similar drugs. This knowledge can be applied to optimize drug formulations, improve drug delivery systems, and develop new therapeutic strategies.
Used in Drug Metabolism Studies:
3-Hydroxyguanfacine is used as a biomarker in drug metabolism studies to evaluate the metabolic pathways and enzyme activities involved in the conversion of Guanfacine. This information can help researchers understand the factors that influence drug metabolism, such as genetic variations, disease states, and drug interactions, ultimately leading to personalized medicine and more effective treatment options.
Check Digit Verification of cas no
The CAS Registry Mumber 78197-84-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,1,9 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 78197-84:
(7*7)+(6*8)+(5*1)+(4*9)+(3*7)+(2*8)+(1*4)=179
179 % 10 = 9
So 78197-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2N3O2/c10-5-1-2-6(15)8(11)4(5)3-7(16)14-9(12)13/h1-2,15H,3H2,(H4,12,13,14,16)
