78324-76-2 Usage
Heterocyclic structure
1H-Anthra[2,3-d]triazole-5,10-dione has a unique structure that includes a central ring with nitrogen atoms, which distinguishes it from other anthraquinone compounds.
Derivation from anthraquinone
This chemical compound is derived from anthraquinone by substituting a nitrogen atom in the central ring, resulting in its distinct properties.
Anthraquinone class
1H-Anthra[2,3-d]triazole-5,10-dione belongs to the anthraquinone class of compounds, which are known for their wide range of applications in various fields.
Potential applications
1H-Anthra[2,3-d]triazole-5,10-dione has potential uses in organic synthesis, pharmaceuticals, and materials science due to its unique properties and structure.
Fluorescent properties
1H-Anthra[2,3-d]triazole-5,10-dione exhibits interesting fluorescent properties, making it a potential candidate for use as a fluorescent probe.
Fluorescent probe for metal ions
Studies have explored the use of 1H-Anthra[2,3-d]triazole-5,10-dione as a fluorescent probe for detecting metal ions, which could have applications in analytical chemistry and environmental monitoring.
Building block for organic electronic materials
The compound's structure and properties make it a suitable building block for designing organic electronic materials, such as organic light-emitting diodes (OLEDs) and organic solar cells.
Check Digit Verification of cas no
The CAS Registry Mumber 78324-76-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,3,2 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 78324-76:
(7*7)+(6*8)+(5*3)+(4*2)+(3*4)+(2*7)+(1*6)=152
152 % 10 = 2
So 78324-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H7N3O2/c18-13-7-3-1-2-4-8(7)14(19)10-6-12-11(5-9(10)13)15-17-16-12/h1-6H,(H,15,16,17)
