78330-23-1 Usage
General Description
Alcohols, C11-14-iso-, C13-rich, ethoxylated propoxylated is a chemical compound derived from a mixture of C11-14 alcohols, primarily containing C13-based alcohols. It is produced through a process that involves the reaction of ethylene oxide and propylene oxide with the alcohols, resulting in a mixture of ethoxylated and propoxylated compounds. This chemical is commonly used as a surfactant and emulsifier in various industrial and household products, including detergents, personal care products, and agricultural chemicals. It functions to reduce the surface tension of liquids, allowing them to spread more easily and penetrate surfaces, as well as improve the stability and solubility of formulations. Despite its widespread use, the safety and potential environmental impact of this chemical have raised concerns, prompting further research and regulation in its usage.
Check Digit Verification of cas no
The CAS Registry Mumber 78330-23-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,3,3 and 0 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 78330-23:
(7*7)+(6*8)+(5*3)+(4*3)+(3*0)+(2*2)+(1*3)=131
131 % 10 = 1
So 78330-23-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H32O/c1-5-7-8-9-10-11-12-13-15(14(3)4)16-6-2/h14-15H,5-13H2,1-4H3/t15-/m1/s1
