78508-46-0 Usage
Description
(4-bromo-3-methylphenyl)urea is a chemical compound with the molecular formula C8H9BrN2O. It is a urea derivative with a bromo-methylphenyl group attached to the urea functionality. This versatile compound is known for its potential applications in various fields, including organic synthesis, pharmaceuticals, agricultural chemicals, and materials science.
Uses
Used in Organic Synthesis:
(4-bromo-3-methylphenyl)urea is used as a building block in organic synthesis for the creation of various chemical compounds. Its unique structure allows for the formation of new molecules with potential applications in different industries.
Used in Pharmaceutical Production:
In the pharmaceutical industry, (4-bromo-3-methylphenyl)urea is used as a key intermediate in the synthesis of various drugs. Its presence in the molecular structure can contribute to the development of new medications with improved therapeutic properties.
Used in Agricultural Chemicals:
(4-bromo-3-methylphenyl)urea is also utilized in the production of agricultural chemicals, such as pesticides and herbicides. Its potential antibacterial and antifungal properties make it a valuable component in the development of effective crop protection products.
Used in Materials Science:
In the field of materials science, (4-bromo-3-methylphenyl)urea has been studied for its potential use in the development of new polymers and materials with specific properties. Its unique structure can contribute to the creation of innovative materials with enhanced characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 78508-46-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,5,0 and 8 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 78508-46:
(7*7)+(6*8)+(5*5)+(4*0)+(3*8)+(2*4)+(1*6)=160
160 % 10 = 0
So 78508-46-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BrN2O/c1-5-4-6(11-8(10)12)2-3-7(5)9/h2-4H,1H3,(H3,10,11,12)
