78524-68-2

Usage

Uses

Used in Personal Care Products:
1-((Dodecyloxy)methyl)-1-methylpiperidinium chloride is used as a surfactant and antimicrobial agent in the personal care industry for its ability to maintain cleanliness and hygiene in products such as shampoos, soaps, and lotions. Its strong antimicrobial properties help to eliminate harmful microorganisms, ensuring the safety and efficacy of these products.
Used in Disinfectants and Sanitizers:
In the production of disinfectants and sanitizers, 1-((Dodecyloxy)methyl)-1-methylpiperidinium chloride serves as a key component due to its effectiveness in eliminating a wide range of bacteria, viruses, and fungi. Its ability to reduce surface tension aids in the cleaning and emulsifying process, making it a valuable addition to these products.
Used in Industrial Applications:
1-((Dodecyloxy)methyl)-1-methylpiperidinium chloride is also utilized in various industrial applications where its antimicrobial and surfactant properties are beneficial. This includes areas such as water treatment, where it can help to control microbial growth, and in the textile industry, where it can be used to enhance the cleaning process of fabrics.
Overall, 1-((Dodecyloxy)methyl)-1-methylpiperidinium chloride is a versatile compound with a broad range of applications, primarily due to its strong antimicrobial properties and its ability to reduce surface tension. When used responsibly and with proper handling and storage procedures, it offers significant benefits in various industries.

InChI:InChI=1/C19H40NO.ClH/c1-3-4-5-6-7-8-9-10-11-15-18-21-19-20(2)16-13-12-14-17-20;/h3-19H2,1-2H3;1H/q+1;/p-1