785760-03-4 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
3-(3-Aminopropoxy)benzonitrile is used as an intermediate in the production of organic chemicals, playing a crucial role in the synthesis of various pharmaceutical and agrochemical products. Its unique chemical structure allows it to be a versatile building block for the creation of complex compounds.
Used in Material Science:
3-(3-Aminopropoxy)benzonitrile may have potential applications in the field of material science, where its properties could be harnessed to develop new materials with specific characteristics.
Used as a Research Reagent:
In chemical laboratories, 3-(3-Aminopropoxy)benzonitrile serves as a research reagent, facilitating scientific investigations and experiments that contribute to the advancement of chemical knowledge and the development of new chemical processes or products.
Check Digit Verification of cas no
The CAS Registry Mumber 785760-03-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,8,5,7,6 and 0 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 785760-03:
(8*7)+(7*8)+(6*5)+(5*7)+(4*6)+(3*0)+(2*0)+(1*3)=204
204 % 10 = 4
So 785760-03-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O/c11-5-2-6-13-10-4-1-3-9(7-10)8-12/h1,3-4,7H,2,5-6,11H2
