785774-74-5 Usage
Uses
Used in Pharmaceutical Industry:
5,6,7,8-TETRAHYDRO-1,6-NAPHTHYRIDIN-3-OL is used as a potential pharmaceutical candidate for various applications due to its unique structural features and potential biological activity. Its naphthyridine ring system and hydroxyl group may offer opportunities for the development of new drugs and therapeutic agents.
Further research is necessary to explore the specific properties and potential uses of 5,6,7,8-TETRAHYDRO-1,6-NAPHTHYRIDIN-3-OL in the pharmaceutical industry. This includes understanding its interactions with biological targets, evaluating its efficacy and safety, and optimizing its synthesis and formulation for various applications. By studying the compound's characteristics and potential benefits, researchers can unlock its full potential and contribute to the advancement of medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 785774-74-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,8,5,7,7 and 4 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 785774-74:
(8*7)+(7*8)+(6*5)+(5*7)+(4*7)+(3*4)+(2*7)+(1*4)=235
235 % 10 = 5
So 785774-74-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O/c11-7-3-6-4-9-2-1-8(6)10-5-7/h3,5,9,11H,1-2,4H2
785774-74-5Relevant academic research and scientific papers
DIHYDROISOQUINOLINE-2(1H)-CARBOXAMIDE AND RELATED COMPOUNDS AND THEIR USE IN TREATING MEDICAL CONDITIONS
-
Paragraph 000458, (2019/11/04)
The invention provides dihydroisoquinoline-2(1H)-carboxamide and related compounds, pharmaceutical compositions, and their use in the treatment of medical conditions, such as cancer, and in inhibiting HPK1 activity.
An expeditious synthesis of 3-(difluoromethoxy)- and 3-(trifluoromethoxy)-5,6,7,8-tetrahydro-1,6-naphthyridines
Guiadeen, Deodialsingh,Kothandaraman, Shankaran,Yang, Lihu,Mills, Sander G.,MacCoss, Malcolm
scheme or table, p. 6368 - 6370 (2009/04/07)
An expeditious and concise synthesis of 3-(difluoromethoxy)-5,6,7,8-tetrahydro-1,6-naphthyridine and 3-(trifluoromethoxy)-5,6,7,8-tetrahydro-1,6-naphthyridines is described. Starting from N-benzyl piperidone, the key intermediates leading to these two bio
