78641-40-4 Usage
Uses
Used in Pharmaceutical Research:
[(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate serves as a valuable precursor in pharmaceutical research for the synthesis of various biologically active compounds. Its 4-hydroxyphenyl group is particularly advantageous for the development of pharmaceuticals, given its potential to be incorporated into molecules with specific therapeutic effects.
Used in Organic Synthesis:
In the field of organic synthesis, [(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate is utilized for its reactivity, allowing chemists to create a variety of complex organic molecules. The malonate core's chemical properties make it a versatile building block for constructing diverse organic compounds.
Used in Chemical Intermediates Production:
[(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate is also used as a chemical intermediate in the production of other compounds. Its unique structure allows it to be a key component in the synthesis of specialized chemicals used across various industries.
Used in Medicinal Chemistry:
In medicinal chemistry, [(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate is employed for the design and synthesis of new drugs. Its structural features can be manipulated to create molecules with specific binding affinities and selectivity towards biological targets, potentially leading to the development of novel therapeutic agents.
Used in the Development of Prodrugs:
[(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate can be used in the development of prodrugs, which are biologically inactive compounds that can be metabolized in the body to produce an active drug. Its malonate core and phenyl groups provide opportunities for the creation of prodrugs with improved pharmacokinetic properties.
Used in the Synthesis of Bioactive Molecules:
[(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate is instrumental in the synthesis of bioactive molecules with potential applications in various therapeutic areas. Its structural elements can be tailored to target specific pathways or receptors, contributing to the discovery of new treatments for a range of diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 78641-40-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,6,4 and 1 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 78641-40:
(7*7)+(6*8)+(5*6)+(4*4)+(3*1)+(2*4)+(1*0)=154
154 % 10 = 4
So 78641-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H16O6/c1-22-14-8-2-11(3-9-14)10-23-17(21)15(16(19)20)12-4-6-13(18)7-5-12/h2-9,15,18H,10H2,1H3,(H,19,20)
