78641-42-6 Usage
Uses
Used in Organic Synthesis:
[[(2,5-dioxopyrrolidin-1-yl)oxy]carbonyl](4-hydroxyphenyl)acetic acid is used as a building block in organic synthesis for the creation of more complex molecules. The presence of the pyrrolidin-1-yl carbonyl group allows for further chemical reactions and modifications, making it a versatile component in the synthesis of various compounds.
Used in Pharmaceutical Development:
In the pharmaceutical industry, [[(2,5-dioxopyrrolidin-1-yl)oxy]carbonyl](4-hydroxyphenyl)acetic acid is used as a potential active pharmaceutical ingredient (API) due to its complex structure and the presence of biologically active functional groups. The phenyl and acetic acid moieties may contribute to its interaction with biological targets, making it a candidate for the development of new drugs.
Used in Drug Delivery Systems:
Similar to other complex molecules, [[(2,5-dioxopyrrolidin-1-yl)oxy]carbonyl](4-hydroxyphenyl)acetic acid can be employed in the development of drug delivery systems. Its structural features may allow for the encapsulation or conjugation with drug molecules, enhancing their stability, solubility, and targeted delivery to specific tissues or cells.
Used in Chemical Research:
In the field of chemical research, [[(2,5-dioxopyrrolidin-1-yl)oxy]carbonyl](4-hydroxyphenyl)acetic acid serves as a subject of study for understanding the properties and reactivity of complex molecules. Its unique structure can provide insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Used in Material Science:
The complex structure of [[(2,5-dioxopyrrolidin-1-yl)oxy]carbonyl](4-hydroxyphenyl)acetic acid may also find applications in material science, where it could be used to develop new materials with specific properties. Its functional groups could potentially be involved in the formation of polymers or other materials with unique characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 78641-42-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,6,4 and 1 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 78641-42:
(7*7)+(6*8)+(5*6)+(4*4)+(3*1)+(2*4)+(1*2)=156
156 % 10 = 6
So 78641-42-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO7/c15-8-3-1-7(2-4-8)11(12(18)19)13(20)21-14-9(16)5-6-10(14)17/h1-4,11,15H,5-6H2,(H,18,19)
