786593-22-4 Usage
Uses
Used in Pharmaceutical Industry:
2-(Bromomethyl)benzoic acid is used as a building block for the synthesis of various pharmaceuticals, including drugs for the treatment of different diseases. Its versatile chemical structure allows for the attachment of different functional groups, enabling the development of new and effective medications.
Used in Agrochemical Industry:
2-(Bromomethyl)benzoic acid is used as a key intermediate in the production of various agrochemicals, such as pesticides and herbicides. Its ability to undergo different chemical reactions allows for the creation of compounds with specific properties, making it a valuable component in the development of agricultural chemicals.
Used in Organic Synthesis:
2-(Bromomethyl)benzoic acid is used as a versatile intermediate in organic synthesis for the preparation of a wide range of organic compounds with various functional groups. Its reactivity and the presence of the bromomethyl functional group make it a valuable building block for the synthesis of complex organic molecules.
Used in Research and Development:
2-(Bromomethyl)benzoic acid is used in research and development for the exploration of new chemical reactions and transformations. Its unique structure and reactivity make it an interesting compound for scientists to study and develop new synthetic routes and methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 786593-22-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,8,6,5,9 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 786593-22:
(8*7)+(7*8)+(6*6)+(5*5)+(4*9)+(3*3)+(2*2)+(1*2)=224
224 % 10 = 4
So 786593-22-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2,(H,10,11)
