78685-99-1 Usage
Description
1-(2',4',5-trimethoxybenzyl)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline is a complex chemical compound characterized by a benzyl group with three methoxy substituents and two hydroxyl groups. It features a tetrahydroisoquinoline backbone with a dihydroxy substitution, which contributes to its potential as a drug candidate. 1-(2',4',5-trimethoxybenzyl)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline exhibits a range of biological activities, such as antioxidant, anti-inflammatory, and neuroprotective properties, making it a promising target for further research and drug development.
Uses
Used in Pharmaceutical Industry:
1-(2',4',5-trimethoxybenzyl)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline is used as a potential drug candidate for its antioxidant, anti-inflammatory, and neuroprotective properties. Its unique structure and diverse functional groups allow for the modulation of various biological pathways, offering therapeutic benefits in treating a range of conditions.
Used in Drug Development:
In the field of drug development, 1-(2',4',5-trimethoxybenzyl)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline serves as a promising starting point for the design and synthesis of novel therapeutic agents. Its multifaceted biological activities and structural features make it an attractive candidate for further exploration and optimization to develop more effective and targeted treatments for various diseases.
Used in Research and Development:
1-(2',4',5-trimethoxybenzyl)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline is utilized as a key compound in research and development efforts, particularly in the study of its antioxidant, anti-inflammatory, and neuroprotective properties. Its complex structure and functional groups provide a foundation for understanding the mechanisms of action and potential applications in various therapeutic areas.
Used in Chemical Synthesis:
In the chemical synthesis industry, 1-(2',4',5-trimethoxybenzyl)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline can be employed as a building block or intermediate for the creation of more complex molecules with specific biological activities. Its unique structure and functional groups make it a valuable component in the synthesis of novel compounds with potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 78685-99-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,6,8 and 5 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 78685-99:
(7*7)+(6*8)+(5*6)+(4*8)+(3*5)+(2*9)+(1*9)=201
201 % 10 = 1
So 78685-99-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H23NO5.ClH/c1-23-17-10-19(25-3)18(24-2)8-12(17)6-14-13-9-16(22)15(21)7-11(13)4-5-20-14;/h7-10,14,20-22H,4-6H2,1-3H3;1H