78734-65-3 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-N-(1-CYANO-CYCLOPENTYL)-ACETAMIDE is used as a synthetic building block for the development of various pharmaceutical products. Its unique structure allows it to be a key component in the synthesis of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-CHLORO-N-(1-CYANO-CYCLOPENTYL)-ACETAMIDE is utilized as a synthetic building block for the preparation of agrochemical products. Its properties make it suitable for the development of new compounds with potential applications in agriculture, such as pesticides or herbicides.
Used in Organic Synthesis:
2-CHLORO-N-(1-CYANO-CYCLOPENTYL)-ACETAMIDE is used as a reagent in organic synthesis, particularly for the creation of complex organic molecules. Its unique structure and properties make it a valuable tool for chemists working on the development of new organic compounds.
Used in Medicinal Chemistry and Drug Discovery:
Due to its unique structure and properties, 2-CHLORO-N-(1-CYANO-CYCLOPENTYL)-ACETAMIDE may have potential applications in medicinal chemistry and drug discovery. It can be used as a starting material or intermediate in the synthesis of new compounds with potential therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 78734-65-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,7,3 and 4 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 78734-65:
(7*7)+(6*8)+(5*7)+(4*3)+(3*4)+(2*6)+(1*5)=173
173 % 10 = 3
So 78734-65-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11ClN2O/c9-5-7(12)11-8(6-10)3-1-2-4-8/h1-5H2,(H,11,12)
