78740-20-2 Usage
Purine ring structure
The compound contains a purine ring, which is a bicyclic ring system consisting of a six-membered pyrimidine ring fused to a five-membered imidazole ring.
Dihydroxypropyl group
A functional group consisting of a propyl chain (three carbon atoms) with two hydroxyl (OH) groups attached to the second and third carbon atoms.
Dimethyl group
A functional group consisting of two methyl (CH3) groups attached to the same carbon atom.
Amino group attached to a phenylmethyl moiety
An amino group (NH2) is connected to a phenyl group (a six-membered ring with alternating single and double carbon-carbon bonds) through a methylene (CH2) group.
Potential pharmacological properties
The compound's structure and functional groups may endow it with biological activity, making it a candidate for drug development or pharmaceutical applications.
Need for further research
To determine the specific biological activities and potential applications of this compound, additional research and analysis are required.
Check Digit Verification of cas no
The CAS Registry Mumber 78740-20-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,7,4 and 0 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 78740-20:
(7*7)+(6*8)+(5*7)+(4*4)+(3*0)+(2*2)+(1*0)=152
152 % 10 = 2
So 78740-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H21N5O4/c1-20-14-13(15(25)21(2)17(20)26)22(9-12(24)10-23)16(19-14)18-8-11-6-4-3-5-7-11/h3-7,12,23-24H,8-10H2,1-2H3,(H,18,19)