78887-36-2 Usage
Uses
Used in Organic Chemistry:
(5-Acetamido-2-nitro)benzeneboronic acid is used as a reagent in organic chemistry for various chemical reactions and syntheses. Its unique structure and properties make it a valuable component in the development of new compounds and materials.
Used in Suzuki Coupling Reactions:
(5-ACETAMIDO-2-NITRO)BENZENEBORONIC ACID is employed as a key reactant in Suzuki coupling reactions, which are palladium-catalyzed coupling reactions that facilitate the formation of carbon-carbon bonds. These reactions are crucial in the synthesis of complex organic molecules and are widely used in the pharmaceutical and chemical industries.
Used in Research:
(5-Acetamido-2-nitro)benzeneboronic acid is utilized in research settings to explore its potential applications and properties. Scientists and researchers use (5-ACETAMIDO-2-NITRO)BENZENEBORONIC ACID to investigate its reactivity, stability, and possible uses in the development of new drugs, materials, or chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 78887-36-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,8,8 and 7 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 78887-36:
(7*7)+(6*8)+(5*8)+(4*8)+(3*7)+(2*3)+(1*6)=202
202 % 10 = 2
So 78887-36-2 is a valid CAS Registry Number.
InChI:InChI=1S/C8H9BN2O5/c1-5(12)10-6-2-3-8(11(15)16)7(4-6)9(13)14/h2-4,13-14H,1H3,(H,10,12)
