79002-96-3 Usage
Uses
Used in Pharmaceutical Industry:
5-AMINO-1-(2,4,6-TRICHLOROPHENYL)-1H-PYRAZOLE-4-CARBONITRILE is used as a key intermediate in the synthesis of various drugs and active pharmaceutical ingredients. Its unique structure, including the trichlorophenyl group, provides specific chemical and pharmacological properties that are valuable for drug discovery and development.
Used in Drug Discovery and Development:
5-AMINO-1-(2,4,6-TRICHLOROPHENYL)-1H-PYRAZOLE-4-CARBONITRILE is utilized for its potential biological activities, such as anti-cancer and anti-inflammatory properties. Its unique structural features make it a promising candidate for the development of new therapeutic agents targeting various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 79002-96-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,0,0 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 79002-96:
(7*7)+(6*9)+(5*0)+(4*0)+(3*2)+(2*9)+(1*6)=133
133 % 10 = 3
So 79002-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H5Cl3N4/c11-6-1-7(12)9(8(13)2-6)17-10(15)5(3-14)4-16-17/h1-2,4H,15H2
79002-96-3Relevant academic research and scientific papers
Pyrazolopyrimidines as CRF antagonists
-
, (2008/06/13)
A compound of the formula: and the pharmaceutically acceptable acid addition salts thereof, wherein A is NR1R2, CR1R2R11, or C(═CR1R12)R2, NHCR1R2R11, OCR1R2R11, SCR1R2R11, NHNR1R2, CR2R11NHR1, CR2R11OR1, CR2R11SR1or C(O)R2; wherein the rest of the variables are herein below defined, used for inflammatory disorders.
