790207-00-0 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate is used as a building block for drug development due to its potential in the synthesis of various heterocyclic compounds with diverse biological activities.
Used in Organic Synthesis:
Ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate is used as an intermediate in organic synthesis, contributing to the development of new materials and compounds with potential applications in various chemical research and development areas.
Check Digit Verification of cas no
The CAS Registry Mumber 790207-00-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,0,2,0 and 7 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 790207-00:
(8*7)+(7*9)+(6*0)+(5*2)+(4*0)+(3*7)+(2*0)+(1*0)=150
150 % 10 = 0
So 790207-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O3/c1-2-12-7(11)6-9-5(3-4-8)13-10-6/h2-4,8H2,1H3
