790207-00-0 Usage
General Description
Ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate is a chemical compound with the molecular formula C8H12N4O4. It is a derivative of oxadiazole, a five-membered organic compound containing nitrogen and oxygen atoms in its ring structure. ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate has potential applications in pharmaceuticals and organic synthesis due to its unique chemical properties. It is used in the synthesis of various heterocyclic compounds, which have diverse biological activities and can be used as building blocks for drug development. Additionally, it can be used in the development of new materials and as an intermediate in organic synthesis. Ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate has potential in various areas of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 790207-00-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,0,2,0 and 7 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 790207-00:
(8*7)+(7*9)+(6*0)+(5*2)+(4*0)+(3*7)+(2*0)+(1*0)=150
150 % 10 = 0
So 790207-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O3/c1-2-12-7(11)6-9-5(3-4-8)13-10-6/h2-4,8H2,1H3
