79055-50-8 Usage
Uses
Used in Pharmaceutical Industry:
2,4-dibromo-5-methylpyridine is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and reactivity make it a valuable component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4-dibromo-5-methylpyridine serves as an intermediate in the production of agrochemicals. Its properties allow for the creation of compounds that can be used in pest control and crop protection, thereby supporting agricultural productivity.
Used in Dye Production:
2,4-dibromo-5-methylpyridine is utilized in the manufacturing process of dyes. Its chemical composition plays a role in the coloration and stability of dyes, which are essential in various industries such as textiles, plastics, and printing inks.
Used in Organic Compounds Synthesis:
2,4-dibroMo-5-Methylpyridine is also used as a building block in the synthesis of other organic compounds. Its versatility in chemical reactions enables the production of a wide range of organic molecules for different applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 79055-50-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,0,5 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 79055-50:
(7*7)+(6*9)+(5*0)+(4*5)+(3*5)+(2*5)+(1*0)=148
148 % 10 = 8
So 79055-50-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5Br2N/c1-4-3-9-6(8)2-5(4)7/h2-3H,1H3
