792-26-7 Usage
Uses
Used in Pharmaceutical Industry:
9-Fluorenone-2,7-dicarboxylic Acid is used as an active pharmaceutical ingredient for the development of drugs targeting bacterial infections. Its chemical structure allows for the modulation of bacterial cell processes, leading to the inhibition or killing of bacteria responsible for infections.
Used in Chemical Industry:
9-Fluorenone-2,7-dicarboxylic Acid can be utilized as a building block or intermediate in the synthesis of various chemical compounds and materials. Its carboxylic acid groups enable it to participate in a range of chemical reactions, making it a versatile component in the creation of new molecules and products.
Used in Antimicrobial Applications:
9-Fluorenone-2,7-dicarboxylic Acid is employed as an antimicrobial agent, effective in treating, ameliorating, or preventing bacterial infections. Its ability to target and disrupt bacterial processes makes it a valuable tool in combating infections and promoting overall health.
Check Digit Verification of cas no
The CAS Registry Mumber 792-26-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,9 and 2 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 792-26:
(5*7)+(4*9)+(3*2)+(2*2)+(1*6)=87
87 % 10 = 7
So 792-26-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H8O5/c16-13-11-5-7(14(17)18)1-3-9(11)10-4-2-8(15(19)20)6-12(10)13/h1-6H,(H,17,18)(H,19,20)
