792180-52-0 Usage
Uses
Used in Pharmaceutical Industry:
5-BROMO-2-(PIPERIDIN-4-YLOXY)PYRIMIDINE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drug candidates. Its specific pharmacological properties, derived from the piperidine group, make it instrumental in creating innovative therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 5-BROMO-2-(PIPERIDIN-4-YLOXY)PYRIMIDINE is utilized as a building block in the synthesis of agrochemicals, playing a crucial role in the formulation of effective and targeted pest control solutions.
Used in Fine Chemicals Industry:
5-BROMO-2-(PIPERIDIN-4-YLOXY)PYRIMIDINE is employed as an intermediate in the production of fine chemicals, where its unique structural features and solubility properties are leveraged to create high-quality specialty chemicals for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 792180-52-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,2,1,8 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 792180-52:
(8*7)+(7*9)+(6*2)+(5*1)+(4*8)+(3*0)+(2*5)+(1*2)=180
180 % 10 = 0
So 792180-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BrN3O/c10-7-5-12-9(13-6-7)14-8-1-3-11-4-2-8/h5-6,8,11H,1-4H2
