79270-78-3 Usage
Uses
Used in Industrial Applications:
2-Ethylhexyl 2-(2,4-dichlorophenoxy)propionate is used as a chemical intermediate for the synthesis of various industrial products. Its specific role in these applications is not well-detailed in existing literature, highlighting the need for further research on 2-Ethylhexyl 2-(2,4-dichlorophenoxy)propionate.
Used in Laboratory Settings:
2-Ethylhexyl 2-(2,4-dichlorophenoxy)propionate is used as a research compound in scientific studies. Its potential applications and properties are being investigated to better understand its behavior and possible uses in various fields.
Note: The exact uses or potential hazards of 2-Ethylhexyl 2-(2,4-dichlorophenoxy)propionate are not well-detailed in existing literature, and further research is needed to determine its specific applications and safety guidelines. Additionally, the specifics of its physical and chemical properties, including its solubility, melting point, boiling point, toxicity levels, handling precautions, and disposal guidelines, are also not well-defined.
Check Digit Verification of cas no
The CAS Registry Mumber 79270-78-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,2,7 and 0 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 79270-78:
(7*7)+(6*9)+(5*2)+(4*7)+(3*0)+(2*7)+(1*8)=163
163 % 10 = 3
So 79270-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H24Cl2O3/c1-4-6-7-13(5-2)11-21-17(20)12(3)22-16-9-8-14(18)10-15(16)19/h8-10,12-13H,4-7,11H2,1-3H3
