793675-05-5 Usage
Uses
Used in Pharmaceutical Industry:
(5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride is used as a building block in the synthesis of various organic compounds for pharmaceutical applications. Its unique structure allows for the development of new drugs with potential therapeutic effects.
Used in Organic Synthesis:
In the field of organic synthesis, (5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride serves as a key intermediate for the creation of complex organic molecules. Its versatile structure enables the formation of a wide range of compounds with diverse applications.
Used in Drug Discovery:
Due to its potential biological activity, (5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride may be utilized in drug discovery processes. Further research and studies are required to explore its full potential in developing new therapeutic agents.
Used in Enhancing Solubility:
The dihydrochloride salt form of (5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride improves its solubility in water, which can be advantageous for certain pharmaceutical applications, such as drug delivery and formulation development.
Further research and studies are necessary to fully understand the potential uses and properties of (5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride, allowing for its optimal utilization in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 793675-05-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,3,6,7 and 5 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 793675-05:
(8*7)+(7*9)+(6*3)+(5*6)+(4*7)+(3*5)+(2*0)+(1*5)=215
215 % 10 = 5
So 793675-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N3.2ClH/c1-9-2-3-11(13-8-9)14-10-4-6-12-7-5-10;;/h2-3,8,10,12H,4-7H2,1H3,(H,13,14);2*1H
793675-05-5Relevant academic research and scientific papers
METHOD FOR MANUFACTURING 4-(5-METHYLPYRIDIN-2-YLAMINO)PIPERIDINE-1-CARBOXYLIC ACID DERIVATIVE
-
Page/Page column 6-7, (2012/06/16)
A novel method for manufacturing 5-methyl-2-(piperidin-4-ylamino)pyridine is established. This method can be used as an industrial manufacturing method to produce a 4-(5-methylpyridin-2-ylamino)piperidine-1-carboxylic acid derivative represented by the general formula, (wherein R represents a linear or branched alkyl group having 1 to 6 carbon atoms or an aralkyl group having 7 to 12 carbon atoms) in a reaction solution having an aromatic monocyclic hydrocarbon as a reaction medium, in the presence of sodium triacetoxyborohydride as a reducing agent, or after adding sodium borohydride and acetic acid to the reaction solution in advance.
