79430-84-5 Usage
Uses
Used in Pharmaceutical Industry:
4-[(benzyl)amino]butyramide monohydrochloride is used as a pharmaceutical intermediate for the synthesis of various drugs targeting the central nervous system. Its unique structure allows for the development of compounds with potential therapeutic effects on neurological disorders and conditions.
Used in Drug Development:
4-[(benzyl)amino]butyramide monohydrochloride is used in the development of new drugs with potential applications in treating central nervous system disorders. Its chemical properties and structure make it a valuable candidate for further research and development, potentially leading to the discovery of novel therapeutic agents.
Used in Research and Development:
4-[(benzyl)amino]butyramide monohydrochloride is used in research and development for exploring its biological and medicinal properties. Its unique structure and potential interactions with biological targets make it an interesting compound for studying its effects on various biological processes and its potential use in the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 79430-84-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,4,3 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 79430-84:
(7*7)+(6*9)+(5*4)+(4*3)+(3*0)+(2*8)+(1*4)=155
155 % 10 = 5
So 79430-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O.ClH/c12-11(14)7-4-8-13-9-10-5-2-1-3-6-10;/h1-3,5-6,13H,4,7-9H2,(H2,12,14);1H
79430-84-5Relevant academic research and scientific papers
Process for the production of 4-aminobutyramide hydrochloride
-
, (2008/06/13)
4-aminobutyramide hydrochloride is produced by saponifying 4-(benzylamino)-or-4-(dibenzylamino)-butyronitrile to the corresponding substituted 4-aminobutyramide and subjecting this in the form of the hydrochloride in the presence of an inert solvent and a platinum metal catalyst to a hydrogenation treatment whereby the benzyl group or the two benzyl groups are split off.