79473-10-2 Usage
Uses
Used in Drug Discovery:
5-azido-1H-indole-3-acetic acid is used as a key intermediate in the synthesis of various bioactive compounds, including potential anticancer agents. Its unique chemical properties and reactivity in click chemistry reactions enable the rapid and efficient synthesis of novel drug candidates with improved pharmacological properties.
Used in Chemical Biology Research:
5-azido-1H-indole-3-acetic acid is employed as a versatile tool in chemical biology research, particularly for the development of molecular probes and imaging agents. Its ability to participate in click chemistry reactions allows for the precise and selective labeling of biomolecules, enabling researchers to study their structure, function, and interactions in living systems.
Used in Bioconjugation:
5-azido-1H-indole-3-acetic acid is used as a bioconjugation agent for the attachment of various functional groups, such as fluorescent dyes, affinity tags, or therapeutic agents, to biomolecules like proteins, peptides, or nucleic acids. The high selectivity and efficiency of click chemistry reactions facilitate the formation of stable and specific bioconjugates, which are essential for various applications in diagnostics, therapeutics, and biotechnology.
Used in Plant Growth Regulation:
5-azido-1H-indole-3-acetic acid is used as a plant growth regulator, owing to its structural similarity to indole-3-acetic acid, a naturally occurring plant hormone. By modulating plant growth and development, 5-azido-1H-indole-3-acetic acid can be employed in agricultural applications to improve crop yield, quality, and resistance to environmental stressors.
Used in Synthesis of Advanced Materials:
5-azido-1H-indole-3-acetic acid can be utilized in the synthesis of advanced materials with unique properties, such as self-healing polymers, stimuli-responsive materials, or functional coatings. The azide group in the compound allows for the incorporation of various functional groups through click chemistry reactions, enabling the development of materials with tailored properties for specific applications in electronics, sensors, or environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 79473-10-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,4,7 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 79473-10:
(7*7)+(6*9)+(5*4)+(4*7)+(3*3)+(2*1)+(1*0)=162
162 % 10 = 2
So 79473-10-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N4O2/c11-14-13-7-1-2-9-8(4-7)6(5-12-9)3-10(15)16/h1-2,4-5,12H,3H2,(H,15,16)
