79473-10-2 Usage
General Description
5-azido-1H-indole-3-acetic acid is a chemical compound with the molecular formula C11H9N5O2. It belongs to the class of indole-3-acetic acid derivatives, which are known for their biological activities, such as plant growth regulation and potential anticancer properties. The compound contains an azide group, which makes it useful for click chemistry reactions, a powerful and versatile tool for bioconjugation and chemical biology research. 5-azido-1H-indole-3-acetic acid has been studied for its potential applications in drug discovery and chemical biology, showing promise as a versatile tool for the development of bioactive compounds and molecular probes.
Check Digit Verification of cas no
The CAS Registry Mumber 79473-10-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,4,7 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 79473-10:
(7*7)+(6*9)+(5*4)+(4*7)+(3*3)+(2*1)+(1*0)=162
162 % 10 = 2
So 79473-10-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N4O2/c11-14-13-7-1-2-9-8(4-7)6(5-12-9)3-10(15)16/h1-2,4-5,12H,3H2,(H,15,16)