795309-07-8 Usage
Uses
Used in Pharmaceutical Research:
(1S,2R)-(-)-2-AMINO-1-CYCLOHEX-4-ENECARBOXYLIC ACID HYDROCHLORIDE is used as a building block for the synthesis of complex molecules and drug candidates due to its unique structure and stereochemistry.
Used in Chemical Research:
(1S,2R)-(-)-2-AMINO-1-CYCLOHEX-4-ENECARBOXYLIC ACID HYDROCHLORIDE is used as a research compound to study its properties and potential applications in various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 795309-07-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,5,3,0 and 9 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 795309-07:
(8*7)+(7*9)+(6*5)+(5*3)+(4*0)+(3*9)+(2*0)+(1*7)=198
198 % 10 = 8
So 795309-07-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO2.ClH/c8-6-4-2-1-3-5(6)7(9)10;/h1-2,5-6H,3-4,8H2,(H,9,10);1H/t5-,6+;/m0./s1
