79598-73-5 Usage
Uses
Used in Pharmaceutical Industry:
(cis)-3-Hydroxy-cyclopentanecarboxylic acid Methyl ester is used as a synthetic reagent for the production of cholinergic compounds, specifically for the synthesis of epi-desmethyldesethermuscarine. Cholinergic compounds are known for their ability to stimulate the parasympathetic nervous system and have potential applications in the treatment of various neurological disorders and conditions related to the cholinergic system.
In the synthesis process, (cis)-3-Hydroxy-cyclopentanecarboxylic acid Methyl ester serves as a crucial building block, providing the necessary structural elements for the formation of the target cholinergic compound. Its unique molecular features enable the formation of specific chemical bonds and interactions that are essential for the biological activity of the final product.
Overall, (cis)-3-Hydroxy-cyclopentanecarboxylic acid Methyl ester is a valuable reagent in the pharmaceutical industry, particularly for the development of cholinergic compounds with potential therapeutic applications. Its unique structure and synthetic utility make it an important component in the ongoing research and development of new drugs and treatments for various neurological conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 79598-73-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,5,9 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 79598-73:
(7*7)+(6*9)+(5*5)+(4*9)+(3*8)+(2*7)+(1*3)=205
205 % 10 = 5
So 79598-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O3/c1-10-7(9)5-2-3-6(8)4-5/h5-6,8H,2-4H2,1H3/t5-,6+/m1/s1
