79673-54-4 Usage
Description
1,4-dimethyl-1H-pyrrole-2-acetic acid is a chemical compound with the molecular formula C8H11NO2. It is a derivative of pyrrole and contains a carboxylic acid functional group. 1,4-dimethyl-1H-pyrrole-2-acetic acid is recognized for its potential biological and pharmacological properties, as well as its utility as a building block in organic synthesis.
Uses
Used in Pharmaceutical Industry:
1,4-dimethyl-1H-pyrrole-2-acetic acid is utilized as a key building block in the synthesis of various pharmaceutical agents. Its presence in some natural products underscores its potential for developing new drugs with diverse therapeutic applications.
Used in Organic Synthesis:
As a versatile intermediate, 1,4-dimethyl-1H-pyrrole-2-acetic acid is used in organic synthesis for creating a range of chemical compounds. Its carboxylic acid functional group allows for various chemical reactions, facilitating the production of complex organic molecules.
Used in Biological Research:
1,4-dimethyl-1H-pyrrole-2-acetic acid is employed in biological research for studying its role in inhibiting the enzyme heme oxygenase-1. This enzyme is implicated in several physiological processes, and understanding the compound's interaction with it can lead to insights into various disease mechanisms.
Used in Therapeutic Development:
1,4-dimethyl-1H-pyrrole-2-acetic acid has shown promise as a therapeutic agent for conditions such as inflammation, cancer, and cardiovascular disease. Its potential to modulate biological pathways involved in these conditions makes it a candidate for further research and development in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 79673-54-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,6,7 and 3 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 79673-54:
(7*7)+(6*9)+(5*6)+(4*7)+(3*3)+(2*5)+(1*4)=184
184 % 10 = 4
So 79673-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO2/c1-6-3-7(4-8(10)11)9(2)5-6/h3,5H,4H2,1-2H3,(H,10,11)