79815-15-9 Usage
Chemical class
Synthetic derivative of tetracycline
Molecular structure
Complex, containing a tetracene-5,12-dione core
Functional groups
Multiple hydroxyl groups
Methoxy group
Amino group
Oxan-2-yl side chain
Core structure
Tetracene-5,12-dione
Antibiotic properties
Potentially similar to tetracycline
Pharmaceutical applications
Possible due to molecular structure and functional groups
Research and testing
Additional research and testing needed to fully understand properties and potential uses
Broad-spectrum antibiotic
Commonly used to treat bacterial infections
Appearance
Not specified in the provided material, but typically a solid or crystalline substance
Please note that the appearance of the compound is not specified in the provided material, but it is generally expected to be a solid or crystalline substance, as is common for many antibiotics and other complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 79815-15-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,8,1 and 5 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 79815-15:
(7*7)+(6*9)+(5*8)+(4*1)+(3*5)+(2*1)+(1*5)=169
169 % 10 = 9
So 79815-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C25H27NO9/c1-9-21(28)13(26)8-16(34-9)35-15-7-10(27)6-12-18(15)25(32)20-19(23(12)30)22(29)11-4-3-5-14(33-2)17(11)24(20)31/h3-5,9-10,13,15-16,21,27-28,30,32H,6-8,26H2,1-2H3