79886-55-8 Usage
Description
N-Succinimidyl 4-(4-maleimidophenyl)butyrate is a heterobifunctional protein crosslinking reagent that contains both sulfhydryl and amino reactive groups. It is characterized by a spacer arm of 11.6 angstroms, which allows for the efficient and specific conjugation of proteins.
Uses
Used in Bioconjugation Applications:
N-Succinimidyl 4-(4-maleimidophenyl)butyrate is used as a crosslinking agent for the covalent attachment of proteins, particularly in the fields of biochemistry, molecular biology, and biotechnology. Its sulfhydryl and amino reactive groups enable the selective and specific conjugation of proteins, leading to the formation of stable and functional bioconjugates.
Used in Drug Delivery Systems:
In the pharmaceutical industry, N-Succinimidyl 4-(4-maleimidophenyl)butyrate is used as a crosslinking agent for the development of drug delivery systems. Its ability to covalently attach proteins to drug carriers, such as nanoparticles or liposomes, allows for the targeted delivery of therapeutic agents to specific cells or tissues, improving the efficacy and reducing the side effects of the treatment.
Used in Biosensor Development:
N-Succinimidyl 4-(4-maleimidophenyl)butyrate is also employed in the development of biosensors, where it is used to immobilize proteins or enzymes onto sensor surfaces. The stable and specific attachment of proteins ensures the efficient and sensitive detection of target molecules, making it a valuable tool in diagnostics and environmental monitoring.
Used in Research and Development:
In academic and industrial research settings, N-Succinimidyl 4-(4-maleimidophenyl)butyrate is used as a versatile crosslinking agent for various applications, including the study of protein-protein interactions, the development of novel biomaterials, and the investigation of enzyme mechanisms. Its unique properties make it a valuable tool for advancing scientific knowledge and developing innovative solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 79886-55-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,8,8 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 79886-55:
(7*7)+(6*9)+(5*8)+(4*8)+(3*6)+(2*5)+(1*5)=208
208 % 10 = 8
So 79886-55-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H16N2O6/c21-14-8-9-15(22)19(14)13-6-4-12(5-7-13)2-1-3-18(25)26-20-16(23)10-11-17(20)24/h4-9H,1-3,10-11H2