79890-07-6 Usage
Uses
Used in Pharmaceutical Research and Development:
3-Imidazo[2,1-b][1,3]benzothiazol-2-ylaniline is used as a building block in the synthesis of biologically active compounds for pharmaceutical research and development. Its unique structure and functional groups contribute to the creation of new drug candidates with potential therapeutic applications.
Used in Drug Discovery:
3-Imidazo[2,1-b][1,3]benzothiazol-2-ylaniline is used as a target for drug discovery due to its potential biological activities. Its unique structure allows for the exploration of various chemical modifications to enhance its properties and optimize its therapeutic potential.
Used in Medicinal Chemistry:
3-Imidazo[2,1-b][1,3]benzothiazol-2-ylaniline is used in medicinal chemistry for the design and development of novel therapeutic agents. Its heterocyclic nature and functional groups provide a versatile platform for the synthesis of diverse chemical entities with potential applications in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 79890-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,8,9 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 79890-07:
(7*7)+(6*9)+(5*8)+(4*9)+(3*0)+(2*0)+(1*7)=186
186 % 10 = 6
So 79890-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H11N3S/c16-11-5-3-4-10(8-11)12-9-18-13-6-1-2-7-14(13)19-15(18)17-12/h1-9H,16H2
79890-07-6Relevant academic research and scientific papers
Imidazobenzothiazoles. 2. New Immunosuppressive Agents
Mase, Toshiyasu,Arima, Hideki,Tomioka, Kenichi,Yamada, Toshimitsu,Murase, Kiyoshi
, p. 386 - 394 (2007/10/02)
A series of 2-phenylimidazobenzothiazole derivatives was prepared and tested for immunological activities.Some of the compounds showed significant suppressive activity of delayed type hypersensitivity (DTH) without inhibition of humoral immunity in mice by oral administration.The most active compound was 2-(m-hydroxyphenyl)imidazobenzothiazole (20).