799283-92-4 Usage
Uses
Used in Organic Synthesis:
1-(5-BROMOPYRIMIDIN-2-YL)PIPERIDINE-4-CARBOXYLIC ACID is used as a key intermediate in organic synthesis for the creation of a variety of chemical compounds. Its presence in the synthesis process is crucial due to its ability to react with other molecules, facilitating the formation of new compounds with potential applications in various industries.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(5-BROMOPYRIMIDIN-2-YL)PIPERIDINE-4-CARBOXYLIC ACID is utilized as a building block for the preparation of biologically active molecules. Its chemical structure makes it a valuable component in the development of pharmaceuticals, particularly those targeting specific biological targets. This role is instrumental in drug discovery and development, where it contributes to the creation of new drug candidates with potential therapeutic applications.
Used in Drug Discovery and Development:
1-(5-BROMOPYRIMIDIN-2-YL)PIPERIDINE-4-CARBOXYLIC ACID is employed as a structural component in the design and synthesis of new drug candidates. Its unique properties and reactivity are harnessed to enhance the development of pharmaceuticals with specific therapeutic goals, making it an essential part of the drug discovery and development process.
Used in Research:
1-(5-BROMOPYRIMIDIN-2-YL)PIPERIDINE-4-CARBOXYLIC ACID is also used in research settings to explore its potential applications and to understand its interactions with other molecules. The research into 1-(5-BROMOPYRIMIDIN-2-YL)PIPERIDINE-4-CARBOXYLIC ACID aids in advancing the knowledge of chemical and biological processes, which can lead to the discovery of new uses and applications in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 799283-92-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,9,2,8 and 3 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 799283-92:
(8*7)+(7*9)+(6*9)+(5*2)+(4*8)+(3*3)+(2*9)+(1*2)=244
244 % 10 = 4
So 799283-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BrN3O2/c11-8-5-12-10(13-6-8)14-3-1-7(2-4-14)9(15)16/h5-7H,1-4H2,(H,15,16)