79989-22-3 Usage
Description
(+-)-6-Benzyl-7-methyl-5,6,8,9-tetrahydro-1,2,12-trimethoxy-7H-dibenz( d,f)azonine is a complex chemical compound belonging to the dibenzazonine derivatives. It features a unique structure with benzyl, methyl, and methoxy groups, and possesses diverse chemical properties and structural features. The presence of multiple functional groups makes it an interesting target for pharmaceutical and medicinal research.
Uses
Used in Pharmaceutical Research:
(+-)-6-Benzyl-7-methyl-5,6,8,9-tetrahydro-1,2,12-trimethoxy-7H-dibenz( d,f)azonine is used as a target compound for pharmaceutical research due to its diverse chemical properties and structural features. Its potential applications in the development of new drugs and therapeutic agents make it a promising candidate for further investigation.
Used in Medicinal Research:
In the field of medicinal research, (+-)-6-Benzyl-7-methyl-5,6,8,9-tetrahydro-1,2,12-trimethoxy-7H-dibenz( d,f)azonine is utilized for exploring its synthesis, properties, and potential biological activities. Studying this compound may provide valuable insights for the development of novel pharmaceutical compounds and contribute to advancements in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 79989-22-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,9,8 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 79989-22:
(7*7)+(6*9)+(5*9)+(4*8)+(3*9)+(2*2)+(1*2)=213
213 % 10 = 3
So 79989-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C27H31NO3/c1-28-15-14-20-10-12-23(29-2)18-24(20)26-21(11-13-25(30-3)27(26)31-4)17-22(28)16-19-8-6-5-7-9-19/h5-13,18,22H,14-17H2,1-4H3