80008-09-9 Usage
Molecular Weight
325.82 g/mol
Functional Groups
Amide group: It contains a carbonyl group (C=O) bonded to a nitrogen atom.
Chloroquinoline moiety: A heterocyclic aromatic organic compound derived from quinoline, featuring a chloro (Cl) substitution at position 7.
Substitutions
Dipropyl substitution on the acetamide group: Two propyl (C3H7) groups are attached to the acetamide nitrogen atoms (N,N-dipropyl).
Chemical Structure

Potential Pharmaceutical Applications
Unique Structure: The compound's specific arrangement of functional groups may offer novel interactions with biological targets.
Interaction Potential: The chloroquinoline moiety and amide functionality could potentially engage in various pharmacological interactions, such as binding to specific receptors or enzymes.
Biological Targets
The compound's structure suggests potential interactions with biological macromolecules, including proteins, enzymes, or nucleic acids, which could lead to therapeutic effects.
Synthetic Significance
The compound's synthesis and derivatization could provide insights into structure-activity relationships (SAR) for drug design and development.
Pharmacological Studies
Further investigations are warranted to explore its pharmacokinetic properties, efficacy, and safety profile for various therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80008-09-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,0 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 80008-09:
(7*8)+(6*0)+(5*0)+(4*0)+(3*8)+(2*0)+(1*9)=89
89 % 10 = 9
So 80008-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H22ClN3O/c1-3-9-21(10-4-2)17(22)12-20-15-7-8-19-16-11-13(18)5-6-14(15)16/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,19,20)