80018-21-9 Usage
General Description
The chemical "(6E)-4-chloro-6-[(2-chlorophenyl)-(pentadecylamino)methylidene]cyclohe xa-2,4-dien-1-one" is a compound with a complex molecular structure. It contains a cyclohexa-2,4-dien-1-one ring with a chloro and methylidene group attached to it. Additionally, it has a 2-chlorophenyl group and a pentadecylamino group linked to the cyclohexa-2,4-dien-1-one ring. This chemical may have potential applications in pharmaceuticals or organic synthesis due to its unique structure and functional groups. However, it also poses potential hazards, and its precise properties and uses would require further investigation, analysis, and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 80018-21-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,1 and 8 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 80018-21:
(7*8)+(6*0)+(5*0)+(4*1)+(3*8)+(2*2)+(1*1)=89
89 % 10 = 9
So 80018-21-9 is a valid CAS Registry Number.
InChI:InChI=1/C28H39Cl2NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21-31-28(24-17-14-15-18-26(24)30)25-22-23(29)19-20-27(25)32/h14-15,17-20,22,31H,2-13,16,21H2,1H3/b28-25+