800402-06-6 Usage
Uses
Used in Pharmaceutical Industry:
6-chloro-3-iodopyridin-2-amine is used as a building block for the synthesis of various pharmaceuticals due to its ability to participate in a range of chemical reactions, contributing to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 6-chloro-3-iodopyridin-2-amine is utilized as a key intermediate in the creation of compounds designed to protect crops and enhance agricultural productivity, leveraging its reactivity in chemical synthesis processes.
Used in Medicinal Chemistry and Drug Discovery:
6-chloro-3-iodopyridin-2-amine is employed as a versatile intermediate in medicinal chemistry and drug discovery, where its unique structural features facilitate the exploration of new chemical spaces and the design of innovative molecular entities with potential therapeutic effects.
Used in the Synthesis of Active Pharmaceutical Ingredients (APIs):
6-chloro-3-iodopyridin-2-amine serves as an intermediate in the synthesis of APIs, playing a crucial role in the production of specialized chemicals that are integral to the formulation of effective medications.
Check Digit Verification of cas no
The CAS Registry Mumber 800402-06-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,0,0,4,0 and 2 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 800402-06:
(8*8)+(7*0)+(6*0)+(5*4)+(4*0)+(3*2)+(2*0)+(1*6)=96
96 % 10 = 6
So 800402-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H4ClIN2/c6-4-2-1-3(7)5(8)9-4/h1-2H,(H2,8,9)
