80049-88-3 Usage
General Description
(2-ethylhexenyl)succinic anhydride is a chemical compound used in the production of adhesives and coatings. It belongs to the class of succinic anhydrides, which are commonly used as intermediates in the synthesis of various organic compounds. This particular compound is derived from succinic acid and ethylhexene, and its anhydride form makes it useful in reactions with other chemicals for various industrial applications. It is known for its high reactivity and is often used as a crosslinking agent or a modifying agent in the production of polymers and resins. Additionally, it is also used in the production of esters and as a building block in the synthesis of other complex chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 80049-88-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,4 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 80049-88:
(7*8)+(6*0)+(5*0)+(4*4)+(3*9)+(2*8)+(1*8)=123
123 % 10 = 3
So 80049-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H18O3/c1-3-5-6-9(4-2)7-10-8-11(13)15-12(10)14/h6,10H,3-5,7-8H2,1-2H3/b9-6+
