80120-00-9 Usage
Uses
Used in Neuroscience Research:
4-(3-FLUORO-PHENYL)-1,2,3,6-TETRAHYDRO-PYRIDINE HYDROCHLORIDE SALT is used as a research tool for studying neurological disorders and their underlying mechanisms. Its neuroactive properties make it a valuable compound for investigating the effects of various interventions on the nervous system.
Used in Neuropharmacology:
In the field of neuropharmacology, 4-(3-FLUORO-PHENYL)-1,2,3,6-TETRAHYDRO-PYRIDINE HYDROCHLORIDE SALT is used as a potential therapeutic agent for the development of novel treatments targeting neurological disorders. Its neuroactive nature allows for the exploration of its efficacy in modulating specific neural pathways and receptors, potentially leading to the discovery of new therapeutic approaches.
Used in Drug Development:
4-(3-FLUORO-PHENYL)-1,2,3,6-TETRAHYDRO-PYRIDINE HYDROCHLORIDE SALT is utilized as a lead compound in the development of new drugs for the treatment of neurological conditions. Its unique chemical structure and neuroactive properties provide a foundation for the design and synthesis of more potent and selective drug candidates.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(3-FLUORO-PHENYL)-1,2,3,6-TETRAHYDRO-PYRIDINE HYDROCHLORIDE SALT is used as a starting material or intermediate in the synthesis of various neuroactive drugs. Its hydrochloride salt form improves its solubility and stability, making it easier to incorporate into drug formulations and delivery systems.
Overall, 4-(3-FLUORO-PHENYL)-1,2,3,6-TETRAHYDRO-PYRIDINE HYDROCHLORIDE SALT holds promise in various applications within the fields of neuroscience, neuropharmacology, and drug development. Its potential uses and effects are currently under investigation, with the aim of advancing our understanding of neurological disorders and developing more effective treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 80120-00-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,1,2 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 80120-00:
(7*8)+(6*0)+(5*1)+(4*2)+(3*0)+(2*0)+(1*0)=69
69 % 10 = 9
So 80120-00-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H12FN.ClH/c12-11-3-1-2-10(8-11)9-4-6-13-7-5-9;/h1-4,8,13H,5-7H2;1H
