801316-07-4 Usage
Uses
Used in Pharmaceutical Research:
2,3-dihydrobenzo[b][1,4]dioxin-6-amine hydrochloride is used as a research compound for the development of new therapeutic drugs due to its unique chemical structure and potential applications in treating various medical conditions.
Used in Drug Development:
2,3-dihydrobenzo[b][1,4]dioxin-6-amine hydrochloride is used as a potential drug candidate for the treatment of various medical conditions, although further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 801316-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,0,1,3,1 and 6 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 801316-07:
(8*8)+(7*0)+(6*1)+(5*3)+(4*1)+(3*6)+(2*0)+(1*7)=114
114 % 10 = 4
So 801316-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2.ClH/c9-6-1-2-7-8(5-6)11-4-3-10-7;/h1-2,5H,3-4,9H2;1H
