801316-07-4 Usage
General Description
2,3-dihydrobenzo[b][1,4]dioxin-6-amine hydrochloride is a chemical compound with the molecular formula C8H10ClNO2. It is a hydrochloride salt form of an amine derivative of 2,3-dihydrobenzo[b][1,4]dioxin, which is a heterocyclic compound. This chemical is used in pharmaceutical research as a potential candidate for the development of new therapeutic drugs. It may have potential applications in the treatment of various medical conditions, but further research is needed to fully understand its properties and potential uses. Being a hydrochloride salt, it is water-soluble and has different physical and chemical properties compared to the free base form of the compound.
Check Digit Verification of cas no
The CAS Registry Mumber 801316-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,0,1,3,1 and 6 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 801316-07:
(8*8)+(7*0)+(6*1)+(5*3)+(4*1)+(3*6)+(2*0)+(1*7)=114
114 % 10 = 4
So 801316-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2.ClH/c9-6-1-2-7-8(5-6)11-4-3-10-7;/h1-2,5H,3-4,9H2;1H