80263-70-3 Usage
General Description
(2-(3,4-dihydroxyphenyl)-2-oxoethyl)dimethylsulfonium is a chemical compound that belongs to the class of sulfonium compounds. It consists of a sulfonium group (S+), two methyl groups, and a phenolic group. (2-(3,4-dihydroxyphenyl)-2-oxoethyl)dimethylsulfonium is often used as a reagent in organic synthesis and as a co-catalyst in various chemical reactions. It is known for its ability to undergo nucleophilic substitution reactions and to act as a strong oxidizing agent. Furthermore, it has been studied for its potential therapeutic applications, particularly for its antioxidant and antimicrobial properties. Additionally, it has been explored for its potential use in the development of new materials and as a component in various biological and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 80263-70-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,2,6 and 3 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 80263-70:
(7*8)+(6*0)+(5*2)+(4*6)+(3*3)+(2*7)+(1*0)=113
113 % 10 = 3
So 80263-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O3S/c1-14(2)6-10(13)7-3-4-8(11)9(12)5-7/h3-5H,6H2,1-2H3,(H-,11,12,13)/p+1