80269-97-2 Usage
Uses
Used in Chemical Research:
4-CHLORO-1-(2,4-DIMETHOXYPHENYL)BUTAN-1-ONE is used as a research compound for studying its chemical properties and potential interactions with other substances.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 4-CHLORO-1-(2,4-DIMETHOXYPHENYL)BUTAN-1-ONE is used as a starting material or intermediate in the synthesis of various drug candidates.
Used in Organic Synthesis:
4-CHLORO-1-(2,4-DIMETHOXYPHENYL)BUTAN-1-ONE is employed as a building block in the synthesis of other organic compounds, potentially leading to the development of new chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80269-97-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,2,6 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 80269-97:
(7*8)+(6*0)+(5*2)+(4*6)+(3*9)+(2*9)+(1*7)=142
142 % 10 = 2
So 80269-97-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H15ClO3/c1-15-9-5-6-10(12(8-9)16-2)11(14)4-3-7-13/h5-6,8H,3-4,7H2,1-2H3
