80353-94-2 Usage
Uses
Used in Pharmaceutical Research:
7-Methyl-Imidazo[1,2-a]pyridine-2-carboxylic acid is used as a research compound for exploring its potential pharmaceutical properties. Its unique structure and characteristics make it a candidate for further investigation in the development of new drugs and therapeutic agents.
Used in Medicinal Chemistry:
7-Methyl-Imidazo[1,2-a]pyridine-2-carboxylic acid is used as a building block in the synthesis of more complex molecules with potential medicinal applications. Its heteroaromatic nature allows for the creation of diverse chemical structures that could be utilized in the design of new drugs.
Used in Chemical Research:
7-Methyl-Imidazo[1,2-a]pyridine-2-carboxylic acid is used as a subject of study in chemical research to understand its physical properties, reactivity, and potential interactions with other compounds. This knowledge can contribute to the broader understanding of heteroaromatic compounds and their applications in various fields.
Note: As the provided materials mention that detailed information on the biological activities or safety profiles of 7-Methyl-Imidazo[1,2-a]pyridine-2-carboxylic acid is limited, it is essential to conduct further research to fully determine its potential applications and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 80353-94-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,3,5 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 80353-94:
(7*8)+(6*0)+(5*3)+(4*5)+(3*3)+(2*9)+(1*4)=122
122 % 10 = 2
So 80353-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2/c1-6-2-3-11-5-7(9(12)13)10-8(11)4-6/h2-5H,1H3,(H,12,13)
