803603-49-8 Usage
Uses
Used in Pharmaceutical Research:
(5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)methanamine is used as a research compound for investigating its potential pharmaceutical applications. Its unique structure and possible bioactivity make it a candidate for further exploration in the development of new drugs or therapeutic agents.
Used in Biological Target Identification:
(5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)methanamine is used as a tool in the identification of biological targets, which could be crucial for understanding disease mechanisms or developing targeted therapies. Its interaction with specific biological molecules may provide insights into its potential as a pharmacophore or a lead compound in drug discovery.
Used in Drug Discovery:
(5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)methanamine is used in the drug discovery process to evaluate its potential as a lead compound. Its chemical properties and interactions with biological systems may contribute to the development of new therapeutic agents or the improvement of existing ones.
Check Digit Verification of cas no
The CAS Registry Mumber 803603-49-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,0,3,6,0 and 3 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 803603-49:
(8*8)+(7*0)+(6*3)+(5*6)+(4*0)+(3*3)+(2*4)+(1*9)=138
138 % 10 = 8
So 803603-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4O/c9-5-7-11-12-8(13-7)6-1-3-10-4-2-6/h1-4H,5,9H2
